C11H14Cl2N2 — CID 105311563
1-(2,6-dichlorophenyl)pent-4-enylhydrazine (PubChem CID 105311563) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)pent-4-enylhydrazine.
| Compound Name | 1-(2,6-dichlorophenyl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105311563 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2/c1-2-3-7-10(15-14)11-8(12)5-4-6-9(11)13/h2,4-6,10,15H,1,3,7,14H2 |
| InChIKey | NDKJWYQAJGOUAP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|