C14H22N2 — CID 105311566
1-(2,4,6-trimethylphenyl)pent-4-enylhydrazine (PubChem CID 105311566) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)pent-4-enylhydrazine.
| Compound Name | 1-(2,4,6-trimethylphenyl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105311566 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H22N2/c1-5-6-7-13(16-15)14-11(3)8-10(2)9-12(14)4/h5,8-9,13,16H,1,6-7,15H2,2-4H3 |
| InChIKey | AQGZMOIASAYMMJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|