C14H22N2 — CID 65383239
N-prop-2-enyl-1-(2,4,6-trimethylphenyl)ethane-1,2-diamine (PubChem CID 65383239) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-prop-2-enyl-1-(2,4,6-trimethylphenyl)ethane-1,2-diamine.
| Compound Name | N-prop-2-enyl-1-(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65383239 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-prop-2-enyl-1-(2,4,6-trimethylphenyl)ethane-1,2-diamine |
| SMILES | C=CCNC(CN)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H22N2/c1-5-6-16-13(9-15)14-11(3)7-10(2)8-12(14)4/h5,7-8,13,16H,1,6,9,15H2,2-4H3 |
| InChIKey | DNGUPZZEIVEWAG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|