C12H17N — CID 55282598
1-(2,4,6-trimethylphenyl)prop-2-en-1-amine (PubChem CID 55282598) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)prop-2-en-1-amine.
| Compound Name | 1-(2,4,6-trimethylphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 55282598 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)prop-2-en-1-amine |
| SMILES | C=CC(N)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H17N/c1-5-11(13)12-9(3)6-8(2)7-10(12)4/h5-7,11H,1,13H2,2-4H3 |
| InChIKey | TXTKLDBILFKUKK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|