C20H28N2 — CID 11289465
(1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine (PubChem CID 11289465) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine.
| Compound Name | (1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11289465 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(C)c([C@H](N)[C@@H](N)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H28N2/c1-11-7-13(3)17(14(4)8-11)19(21)20(22)18-15(5)9-12(2)10-16(18)6/h7-10,19-20H,21-22H2,1-6H3/t19-,20-/m0/s1 |
| InChIKey | ILMRHFMYIXTNMC-PMACEKPBSA-N |
| XLogP | 4.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |