C16H25NO — CID 171268340
(1R,2S)-2-amino-1-cyclopentyl-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 171268340) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclopentyl-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclopentyl-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 171268340 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclopentyl-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c([C@H](N)[C@H](O)C2CCCC2)c(C)c1 |
| InChI | InChI=1S/C16H25NO/c1-10-8-11(2)14(12(3)9-10)15(17)16(18)13-6-4-5-7-13/h8-9,13,15-16,18H,4-7,17H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | DIWRVZAIRGTGDM-JKSUJKDBSA-N |
| XLogP | 3.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |