C10H14ClN — CID 116947745
chloro-(2,4,6-trimethylphenyl)methanamine (PubChem CID 116947745) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is chloro-(2,4,6-trimethylphenyl)methanamine.
| Compound Name | chloro-(2,4,6-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 116947745 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | chloro-(2,4,6-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)Cl)c(C)c1 |
| InChI | InChI=1S/C10H14ClN/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5,10H,12H2,1-3H3 |
| InChIKey | AABPHKFYJSRKSX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|