C10H15NO — CID 55276249
2-[(1R)-1-aminoethyl]-3,5-dimethylphenol (PubChem CID 55276249) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(1R)-1-aminoethyl]-3,5-dimethylphenol.
| Compound Name | 2-[(1R)-1-aminoethyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 55276249 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-[(1R)-1-aminoethyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c([C@@H](C)N)c(O)c1 |
| InChI | InChI=1S/C10H15NO/c1-6-4-7(2)10(8(3)11)9(12)5-6/h4-5,8,12H,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | KKEPVAZJQZIXMY-MRVPVSSYSA-N |
| XLogP | 2.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|