C11H17NO2 — CID 130061720
2-(1-amino-2-methoxyethyl)-3,5-dimethylphenol (PubChem CID 130061720) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(1-amino-2-methoxyethyl)-3,5-dimethylphenol.
| Compound Name | 2-(1-amino-2-methoxyethyl)-3,5-dimethylphenol |
|---|---|
| PubChem CID | 130061720 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(1-amino-2-methoxyethyl)-3,5-dimethylphenol |
| SMILES | COCC(N)c1c(C)cc(C)cc1O |
| InChI | InChI=1S/C11H17NO2/c1-7-4-8(2)11(10(13)5-7)9(12)6-14-3/h4-5,9,13H,6,12H2,1-3H3 |
| InChIKey | IICMHEKMAOZKFD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|