C11H17NO2 — CID 55269868
2-(1-aminobutyl)-5-methylbenzene-1,3-diol (PubChem CID 55269868) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(1-aminobutyl)-5-methylbenzene-1,3-diol.
| Compound Name | 2-(1-aminobutyl)-5-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 55269868 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(1-aminobutyl)-5-methylbenzene-1,3-diol |
| SMILES | CCCC(N)c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C11H17NO2/c1-3-4-8(12)11-9(13)5-7(2)6-10(11)14/h5-6,8,13-14H,3-4,12H2,1-2H3 |
| InChIKey | LQQMMNWZCYTZQO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|