C10H12F3NO — CID 131506942
2-[(1S)-1-aminobutyl]-3,4,5-trifluorophenol (PubChem CID 131506942) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-[(1S)-1-aminobutyl]-3,4,5-trifluorophenol.
| Compound Name | 2-[(1S)-1-aminobutyl]-3,4,5-trifluorophenol |
|---|---|
| PubChem CID | 131506942 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[(1S)-1-aminobutyl]-3,4,5-trifluorophenol |
| SMILES | CCC[C@H](N)c1c(O)cc(F)c(F)c1F |
| InChI | InChI=1S/C10H12F3NO/c1-2-3-6(14)8-7(15)4-5(11)9(12)10(8)13/h4,6,15H,2-3,14H2,1H3/t6-/m0/s1 |
| InChIKey | KFZNQDXXXCKTFG-LURJTMIESA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|