C10H11ClF3NO — CID 171254368
2-[(1S)-1-aminobut-3-enyl]-3,4,5-trifluorophenol;hydrochloride (PubChem CID 171254368) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 2-[(1S)-1-aminobut-3-enyl]-3,4,5-trifluorophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-aminobut-3-enyl]-3,4,5-trifluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171254368 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[(1S)-1-aminobut-3-enyl]-3,4,5-trifluorophenol;hydrochloride |
| SMILES | C=CC[C@H](N)c1c(O)cc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C10H10F3NO.ClH/c1-2-3-6(14)8-7(15)4-5(11)9(12)10(8)13;/h2,4,6,15H,1,3,14H2;1H/t6-;/m0./s1 |
| InChIKey | NZYMFRXAIOLPJP-RGMNGODLSA-N |
| XLogP | 2.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|