C11H14FNO — CID 55269488
2-[(1S)-1-aminobut-3-enyl]-4-fluoro-3-methylphenol (PubChem CID 55269488) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-[(1S)-1-aminobut-3-enyl]-4-fluoro-3-methylphenol.
| Compound Name | 2-[(1S)-1-aminobut-3-enyl]-4-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 55269488 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-[(1S)-1-aminobut-3-enyl]-4-fluoro-3-methylphenol |
| SMILES | C=CC[C@H](N)c1c(O)ccc(F)c1C |
| InChI | InChI=1S/C11H14FNO/c1-3-4-9(13)11-7(2)8(12)5-6-10(11)14/h3,5-6,9,14H,1,4,13H2,2H3/t9-/m0/s1 |
| InChIKey | BKBLOAZFOLTCHN-VIFPVBQESA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|