C12H19NO — CID 55296178
4-(1-aminobutyl)-2,6-dimethylphenol (PubChem CID 55296178) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(1-aminobutyl)-2,6-dimethylphenol.
| Compound Name | 4-(1-aminobutyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 55296178 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-(1-aminobutyl)-2,6-dimethylphenol |
| SMILES | CCCC(N)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C12H19NO/c1-4-5-11(13)10-6-8(2)12(14)9(3)7-10/h6-7,11,14H,4-5,13H2,1-3H3 |
| InChIKey | ACFWQRUHEKUCTO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |