C13H22ClNO — CID 171224632
4-[(1S)-1-amino-3-methylbutyl]-2,6-dimethylphenol;hydrochloride (PubChem CID 171224632) has the molecular formula C13H22ClNO and a molecular weight of 243.78 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-methylbutyl]-2,6-dimethylphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3-methylbutyl]-2,6-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 171224632 |
| Molecular Formula | C13H22ClNO |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-[(1S)-1-amino-3-methylbutyl]-2,6-dimethylphenol;hydrochloride |
| SMILES | Cc1cc([C@@H](N)CC(C)C)cc(C)c1O.Cl |
| InChI | InChI=1S/C13H21NO.ClH/c1-8(2)5-12(14)11-6-9(3)13(15)10(4)7-11;/h6-8,12,15H,5,14H2,1-4H3;1H/t12-;/m0./s1 |
| InChIKey | BZCBRKUGUOAUOD-YDALLXLXSA-N |
| XLogP | 3.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |