C11H15Br2NO — CID 131413389
4-[(1S)-1-amino-3-methylbutyl]-2,6-dibromophenol (PubChem CID 131413389) has the molecular formula C11H15Br2NO and a molecular weight of 337.06 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3-methylbutyl]-2,6-dibromophenol.
| Compound Name | 4-[(1S)-1-amino-3-methylbutyl]-2,6-dibromophenol |
|---|---|
| PubChem CID | 131413389 |
| Molecular Formula | C11H15Br2NO |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 4-[(1S)-1-amino-3-methylbutyl]-2,6-dibromophenol |
| SMILES | CC(C)C[C@H](N)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H15Br2NO/c1-6(2)3-10(14)7-4-8(12)11(15)9(13)5-7/h4-6,10,15H,3,14H2,1-2H3/t10-/m0/s1 |
| InChIKey | UOHFPIHZUBGITO-JTQLQIEISA-N |
| XLogP | 3.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |