C11H16Br2ClNO — CID 171219518
4-[(1S)-1-aminopentyl]-2,6-dibromophenol;hydrochloride (PubChem CID 171219518) has the molecular formula C11H16Br2ClNO and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-[(1S)-1-aminopentyl]-2,6-dibromophenol;hydrochloride.
| Compound Name | 4-[(1S)-1-aminopentyl]-2,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171219518 |
| Molecular Formula | C11H16Br2ClNO |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 4-[(1S)-1-aminopentyl]-2,6-dibromophenol;hydrochloride |
| SMILES | CCCC[C@H](N)c1cc(Br)c(O)c(Br)c1.Cl |
| InChI | InChI=1S/C11H15Br2NO.ClH/c1-2-3-4-10(14)7-5-8(12)11(15)9(13)6-7;/h5-6,10,15H,2-4,14H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | HNOWYUGAAXRHAK-PPHPATTJSA-N |
| XLogP | 4.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |