C11H17Br2ClN2O — CID 171219511
2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol;hydrochloride (PubChem CID 171219511) has the molecular formula C11H17Br2ClN2O and a molecular weight of 388.53 g/mol. Its IUPAC name is 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol;hydrochloride.
| Compound Name | 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171219511 |
| Molecular Formula | C11H17Br2ClN2O |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H16Br2N2O.ClH/c12-8-5-7(6-9(13)11(8)16)10(15)3-1-2-4-14;/h5-6,10,16H,1-4,14-15H2;1H/t10-;/m0./s1 |
| InChIKey | LPEVPZLRQIIRKL-PPHPATTJSA-N |
| XLogP | 3.47 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|