C12H18Br2ClNO — CID 171199992
4-[(1R)-1-aminohexyl]-2,6-dibromophenol;hydrochloride (PubChem CID 171199992) has the molecular formula C12H18Br2ClNO and a molecular weight of 387.54 g/mol. Its IUPAC name is 4-[(1R)-1-aminohexyl]-2,6-dibromophenol;hydrochloride.
| Compound Name | 4-[(1R)-1-aminohexyl]-2,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171199992 |
| Molecular Formula | C12H18Br2ClNO |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 4-[(1R)-1-aminohexyl]-2,6-dibromophenol;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1cc(Br)c(O)c(Br)c1.Cl |
| InChI | InChI=1S/C12H17Br2NO.ClH/c1-2-3-4-5-11(15)8-6-9(13)12(16)10(14)7-8;/h6-7,11,16H,2-5,15H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | QGVGMQZFENBXKR-RFVHGSKJSA-N |
| XLogP | 4.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|