C11H16Br2N2O — CID 171219510
2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol (PubChem CID 171219510) has the molecular formula C11H16Br2N2O and a molecular weight of 352.07 g/mol. Its IUPAC name is 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol.
| Compound Name | 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol |
|---|---|
| PubChem CID | 171219510 |
| Molecular Formula | C11H16Br2N2O |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 2,6-dibromo-4-[(1S)-1,5-diaminopentyl]phenol |
| SMILES | NCCCC[C@H](N)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H16Br2N2O/c12-8-5-7(6-9(13)11(8)16)10(15)3-1-2-4-14/h5-6,10,16H,1-4,14-15H2/t10-/m0/s1 |
| InChIKey | AFEZUJFLWZWTKU-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|