C13H22BrClN2O2 — CID 171227035
2-bromo-4-[(1S)-1,5-diaminopentyl]-6-ethoxyphenol;hydrochloride (PubChem CID 171227035) has the molecular formula C13H22BrClN2O2 and a molecular weight of 353.69 g/mol. Its IUPAC name is 2-bromo-4-[(1S)-1,5-diaminopentyl]-6-ethoxyphenol;hydrochloride.
| Compound Name | 2-bromo-4-[(1S)-1,5-diaminopentyl]-6-ethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171227035 |
| Molecular Formula | C13H22BrClN2O2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-bromo-4-[(1S)-1,5-diaminopentyl]-6-ethoxyphenol;hydrochloride |
| SMILES | CCOc1cc([C@@H](N)CCCCN)cc(Br)c1O.Cl |
| InChI | InChI=1S/C13H21BrN2O2.ClH/c1-2-18-12-8-9(7-10(14)13(12)17)11(16)5-3-4-6-15;/h7-8,11,17H,2-6,15-16H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | LBECIQVCBIJCSK-MERQFXBCSA-N |
| XLogP | 3.10 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|