C11H14BrClN2O2 — CID 171260487
(3R)-3-amino-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)propanenitrile;hydrochloride (PubChem CID 171260487) has the molecular formula C11H14BrClN2O2 and a molecular weight of 321.60 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)propanenitrile;hydrochloride.
| Compound Name | (3R)-3-amino-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260487 |
| Molecular Formula | C11H14BrClN2O2 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | (3R)-3-amino-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)propanenitrile;hydrochloride |
| SMILES | CCOc1cc([C@H](N)CC#N)cc(Br)c1O.Cl |
| InChI | InChI=1S/C11H13BrN2O2.ClH/c1-2-16-10-6-7(9(14)3-4-13)5-8(12)11(10)15;/h5-6,9,15H,2-3,14H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | NIZHPYRSWBQJJC-SBSPUUFOSA-N |
| XLogP | 2.89 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |