C11H15Br3N2O — CID 171216396
2,4,6-tribromo-3-[(1R)-1,5-diaminopentyl]phenol (PubChem CID 171216396) has the molecular formula C11H15Br3N2O and a molecular weight of 430.97 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(1R)-1,5-diaminopentyl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(1R)-1,5-diaminopentyl]phenol |
|---|---|
| PubChem CID | 171216396 |
| Molecular Formula | C11H15Br3N2O |
| Molecular Weight | 430.97 g/mol |
| Exact Mass | 427.87 |
| IUPAC Name | 2,4,6-tribromo-3-[(1R)-1,5-diaminopentyl]phenol |
| SMILES | NCCCC[C@@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C11H15Br3N2O/c12-6-5-7(13)11(17)10(14)9(6)8(16)3-1-2-4-15/h5,8,17H,1-4,15-16H2/t8-/m1/s1 |
| InChIKey | KTPMHXRXFCNHGV-MRVPVSSYSA-N |
| XLogP | 3.81 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|