C11H14Br3NO — CID 131530626
3-[(1R)-1-amino-3-methylbutyl]-2,4,6-tribromophenol (PubChem CID 131530626) has the molecular formula C11H14Br3NO and a molecular weight of 415.95 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-methylbutyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(1R)-1-amino-3-methylbutyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 131530626 |
| Molecular Formula | C11H14Br3NO |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 412.86 |
| IUPAC Name | 3-[(1R)-1-amino-3-methylbutyl]-2,4,6-tribromophenol |
| SMILES | CC(C)C[C@@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C11H14Br3NO/c1-5(2)3-8(15)9-6(12)4-7(13)11(16)10(9)14/h4-5,8,16H,3,15H2,1-2H3/t8-/m1/s1 |
| InChIKey | PZMTXPYKHYVIRG-MRVPVSSYSA-N |
| XLogP | 4.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |