C8H10Br3ClN2O — CID 171236025
2,4,6-tribromo-3-[(1R)-1,2-diaminoethyl]phenol;hydrochloride (PubChem CID 171236025) has the molecular formula C8H10Br3ClN2O and a molecular weight of 425.35 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(1R)-1,2-diaminoethyl]phenol;hydrochloride.
| Compound Name | 2,4,6-tribromo-3-[(1R)-1,2-diaminoethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171236025 |
| Molecular Formula | C8H10Br3ClN2O |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 421.80 |
| IUPAC Name | 2,4,6-tribromo-3-[(1R)-1,2-diaminoethyl]phenol;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C8H9Br3N2O.ClH/c9-3-1-4(10)8(14)7(11)6(3)5(13)2-12;/h1,5,14H,2,12-13H2;1H/t5-;/m0./s1 |
| InChIKey | JIYFOCGYWJPLGW-JEDNCBNOSA-N |
| XLogP | 3.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |