C9H9Br3ClNO — CID 171216400
3-[(1R)-1-aminoprop-2-enyl]-2,4,6-tribromophenol;hydrochloride (PubChem CID 171216400) has the molecular formula C9H9Br3ClNO and a molecular weight of 422.34 g/mol. Its IUPAC name is 3-[(1R)-1-aminoprop-2-enyl]-2,4,6-tribromophenol;hydrochloride.
| Compound Name | 3-[(1R)-1-aminoprop-2-enyl]-2,4,6-tribromophenol;hydrochloride |
|---|---|
| PubChem CID | 171216400 |
| Molecular Formula | C9H9Br3ClNO |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 418.79 |
| IUPAC Name | 3-[(1R)-1-aminoprop-2-enyl]-2,4,6-tribromophenol;hydrochloride |
| SMILES | C=C[C@@H](N)c1c(Br)cc(Br)c(O)c1Br.Cl |
| InChI | InChI=1S/C9H8Br3NO.ClH/c1-2-6(13)7-4(10)3-5(11)9(14)8(7)12;/h2-3,6,14H,1,13H2;1H/t6-;/m1./s1 |
| InChIKey | IBLRQWZASCTGHB-FYZOBXCZSA-N |
| XLogP | 4.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|