C10H13Br3N2O — CID 171236028
2,4,6-tribromo-3-[(1S)-1,4-diaminobutyl]phenol (PubChem CID 171236028) has the molecular formula C10H13Br3N2O and a molecular weight of 416.94 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(1S)-1,4-diaminobutyl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(1S)-1,4-diaminobutyl]phenol |
|---|---|
| PubChem CID | 171236028 |
| Molecular Formula | C10H13Br3N2O |
| Molecular Weight | 416.94 g/mol |
| Exact Mass | 413.86 |
| IUPAC Name | 2,4,6-tribromo-3-[(1S)-1,4-diaminobutyl]phenol |
| SMILES | NCCC[C@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C10H13Br3N2O/c11-5-4-6(12)10(16)9(13)8(5)7(15)2-1-3-14/h4,7,16H,1-3,14-15H2/t7-/m0/s1 |
| InChIKey | NWPIGZZSCREOSU-ZETCQYMHSA-N |
| XLogP | 3.42 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.94 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |