C9H8Br3F2NO — CID 131325612
3-[(1R)-1-amino-3,3-difluoropropyl]-2,4,6-tribromophenol (PubChem CID 131325612) has the molecular formula C9H8Br3F2NO and a molecular weight of 423.88 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3,3-difluoropropyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(1R)-1-amino-3,3-difluoropropyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 131325612 |
| Molecular Formula | C9H8Br3F2NO |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 420.81 |
| IUPAC Name | 3-[(1R)-1-amino-3,3-difluoropropyl]-2,4,6-tribromophenol |
| SMILES | N[C@H](CC(F)F)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C9H8Br3F2NO/c10-3-1-4(11)9(16)8(12)7(3)5(15)2-6(13)14/h1,5-6,16H,2,15H2/t5-/m1/s1 |
| InChIKey | BGWFAOMRUIZLEQ-RXMQYKEDSA-N |
| XLogP | 4.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |