C9H10Br3NO2 — CID 131435618
3-[(1R,2S)-1-amino-2-hydroxypropyl]-2,4,6-tribromophenol (PubChem CID 131435618) has the molecular formula C9H10Br3NO2 and a molecular weight of 403.90 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-hydroxypropyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(1R,2S)-1-amino-2-hydroxypropyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 131435618 |
| Molecular Formula | C9H10Br3NO2 |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 400.83 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-hydroxypropyl]-2,4,6-tribromophenol |
| SMILES | C[C@H](O)[C@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C9H10Br3NO2/c1-3(14)8(13)6-4(10)2-5(11)9(15)7(6)12/h2-3,8,14-15H,13H2,1H3/t3-,8-/m0/s1 |
| InChIKey | DTKXTYCNRLNRCL-SUZIUWRMSA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |