C9H12Br2ClNO2 — CID 171261157
4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dibromophenol;hydrochloride (PubChem CID 171261157) has the molecular formula C9H12Br2ClNO2 and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dibromophenol;hydrochloride.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171261157 |
| Molecular Formula | C9H12Br2ClNO2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 358.89 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dibromophenol;hydrochloride |
| SMILES | C[C@H](O)[C@H](N)c1cc(Br)c(O)c(Br)c1.Cl |
| InChI | InChI=1S/C9H11Br2NO2.ClH/c1-4(13)8(12)5-2-6(10)9(14)7(11)3-5;/h2-4,8,13-14H,12H2,1H3;1H/t4-,8-;/m0./s1 |
| InChIKey | PBNUPEYXSBASEA-IUCRYBCLSA-N |
| XLogP | 2.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |