C9H11Cl2NO2 — CID 131154403
4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dichlorophenol (PubChem CID 131154403) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dichlorophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 131154403 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-2,6-dichlorophenol |
| SMILES | C[C@H](O)[C@H](N)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO2/c1-4(13)8(12)5-2-6(10)9(14)7(11)3-5/h2-4,8,13-14H,12H2,1H3/t4-,8-/m0/s1 |
| InChIKey | ZRWOEBOQRLOHOJ-NVNXEXLPSA-N |
| XLogP | 2.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |