C9H11ClFNO — CID 130663904
(1R,2R)-1-amino-1-(3-chloro-4-fluorophenyl)propan-2-ol (PubChem CID 130663904) has the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. Its IUPAC name is (1R,2R)-1-amino-1-(3-chloro-4-fluorophenyl)propan-2-ol.
| Compound Name | (1R,2R)-1-amino-1-(3-chloro-4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 130663904 |
| Molecular Formula | C9H11ClFNO |
| Molecular Weight | 203.64 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (1R,2R)-1-amino-1-(3-chloro-4-fluorophenyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@H](N)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H11ClFNO/c1-5(13)9(12)6-2-3-8(11)7(10)4-6/h2-5,9,13H,12H2,1H3/t5-,9+/m1/s1 |
| InChIKey | UKQZKVLIZLSXJW-ANLVUFKYSA-N |
| XLogP | 1.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |