C9H12ClFN2O — CID 116942560
1,3-diamino-1-(3-chloro-4-fluorophenyl)propan-2-ol (PubChem CID 116942560) has the molecular formula C9H12ClFN2O and a molecular weight of 218.66 g/mol. Its IUPAC name is 1,3-diamino-1-(3-chloro-4-fluorophenyl)propan-2-ol.
| Compound Name | 1,3-diamino-1-(3-chloro-4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 116942560 |
| Molecular Formula | C9H12ClFN2O |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1,3-diamino-1-(3-chloro-4-fluorophenyl)propan-2-ol |
| SMILES | NCC(O)C(N)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H12ClFN2O/c10-6-3-5(1-2-7(6)11)9(13)8(14)4-12/h1-3,8-9,14H,4,12-13H2 |
| InChIKey | NHHAAEUKSBVZIE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |