C9H11Br2NO2 — CID 130990105
2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-dibromophenol (PubChem CID 130990105) has the molecular formula C9H11Br2NO2 and a molecular weight of 325.00 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-dibromophenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 130990105 |
| Molecular Formula | C9H11Br2NO2 |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.92 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4,6-dibromophenol |
| SMILES | C[C@H](O)[C@H](N)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H11Br2NO2/c1-4(13)8(12)6-2-5(10)3-7(11)9(6)14/h2-4,8,13-14H,12H2,1H3/t4-,8-/m0/s1 |
| InChIKey | APOXEDJZHRXPKX-NVNXEXLPSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|