C13H18Br2ClNO2 — CID 171266422
2-[(1S,2R)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4,6-dibromophenol;hydrochloride (PubChem CID 171266422) has the molecular formula C13H18Br2ClNO2 and a molecular weight of 415.55 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4,6-dibromophenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4,6-dibromophenol;hydrochloride |
|---|---|
| PubChem CID | 171266422 |
| Molecular Formula | C13H18Br2ClNO2 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4,6-dibromophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(Br)cc(Br)c1O)[C@H](O)C1CCCC1 |
| InChI | InChI=1S/C13H17Br2NO2.ClH/c14-8-5-9(13(18)10(15)6-8)11(16)12(17)7-3-1-2-4-7;/h5-7,11-12,17-18H,1-4,16H2;1H/t11-,12+;/m0./s1 |
| InChIKey | DCEYOXQWJMEILY-ZVWHLABXSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|