C14H21BrClNO3 — CID 171264824
2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171264824) has the molecular formula C14H21BrClNO3 and a molecular weight of 366.68 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171264824 |
| Molecular Formula | C14H21BrClNO3 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1cc(Br)cc([C@@H](N)[C@@H](O)C2CCCC2)c1O.Cl |
| InChI | InChI=1S/C14H20BrNO3.ClH/c1-19-11-7-9(15)6-10(14(11)18)12(16)13(17)8-4-2-3-5-8;/h6-8,12-13,17-18H,2-5,16H2,1H3;1H/t12-,13+;/m1./s1 |
| InChIKey | RHXJEZFFHRLEJQ-KZCZEQIWSA-N |
| XLogP | 3.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|