C15H23BrClNO3 — CID 171264826
2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171264826) has the molecular formula C15H23BrClNO3 and a molecular weight of 380.71 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171264826 |
| Molecular Formula | C15H23BrClNO3 |
| Molecular Weight | 380.71 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1cc(Br)cc([C@@H](N)[C@@H](O)C2CCCCC2)c1O.Cl |
| InChI | InChI=1S/C15H22BrNO3.ClH/c1-20-12-8-10(16)7-11(15(12)19)13(17)14(18)9-5-3-2-4-6-9;/h7-9,13-14,18-19H,2-6,17H2,1H3;1H/t13-,14+;/m1./s1 |
| InChIKey | KXLNRCNRLOGIAZ-DFQHDRSWSA-N |
| XLogP | 3.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|