C10H14BrNO3 — CID 131422660
2-[(1R,2S)-1-amino-2-hydroxypropyl]-4-bromo-6-methoxyphenol (PubChem CID 131422660) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4-bromo-6-methoxyphenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 131422660 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]-4-bromo-6-methoxyphenol |
| SMILES | COc1cc(Br)cc([C@@H](N)[C@H](C)O)c1O |
| InChI | InChI=1S/C10H14BrNO3/c1-5(13)9(12)7-3-6(11)4-8(15-2)10(7)14/h3-5,9,13-14H,12H2,1-2H3/t5-,9-/m0/s1 |
| InChIKey | INMGSBSFAVEDAI-CDUCUWFYSA-N |
| XLogP | 1.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|