C9H12BrClFNO2 — CID 171212860
2-[(1S)-1-amino-2-fluoroethyl]-4-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171212860) has the molecular formula C9H12BrClFNO2 and a molecular weight of 300.56 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-fluoroethyl]-4-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2-fluoroethyl]-4-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171212860 |
| Molecular Formula | C9H12BrClFNO2 |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 2-[(1S)-1-amino-2-fluoroethyl]-4-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1cc(Br)cc([C@H](N)CF)c1O.Cl |
| InChI | InChI=1S/C9H11BrFNO2.ClH/c1-14-8-3-5(10)2-6(9(8)13)7(12)4-11;/h2-3,7,13H,4,12H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | VBXIXTQHLPWLEF-OGFXRTJISA-N |
| XLogP | 2.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|