C10H14BrClFNO2 — CID 171212888
2-[(1R)-1-amino-3-fluoropropyl]-4-bromo-6-methoxyphenol;hydrochloride (PubChem CID 171212888) has the molecular formula C10H14BrClFNO2 and a molecular weight of 314.58 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-fluoropropyl]-4-bromo-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-fluoropropyl]-4-bromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171212888 |
| Molecular Formula | C10H14BrClFNO2 |
| Molecular Weight | 314.58 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-[(1R)-1-amino-3-fluoropropyl]-4-bromo-6-methoxyphenol;hydrochloride |
| SMILES | COc1cc(Br)cc([C@H](N)CCF)c1O.Cl |
| InChI | InChI=1S/C10H13BrFNO2.ClH/c1-15-9-5-6(11)4-7(10(9)14)8(13)2-3-12;/h4-5,8,14H,2-3,13H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | TWXXGVNSIZAXCG-DDWIOCJRSA-N |
| XLogP | 2.94 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|