C16H24BrNO3 — CID 171267437
(1R,2S)-2-amino-2-(4-bromo-3,5-dimethoxyphenyl)-1-cyclohexylethanol (PubChem CID 171267437) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(4-bromo-3,5-dimethoxyphenyl)-1-cyclohexylethanol.
| Compound Name | (1R,2S)-2-amino-2-(4-bromo-3,5-dimethoxyphenyl)-1-cyclohexylethanol |
|---|---|
| PubChem CID | 171267437 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (1R,2S)-2-amino-2-(4-bromo-3,5-dimethoxyphenyl)-1-cyclohexylethanol |
| SMILES | COc1cc([C@H](N)[C@H](O)C2CCCCC2)cc(OC)c1Br |
| InChI | InChI=1S/C16H24BrNO3/c1-20-12-8-11(9-13(21-2)14(12)17)15(18)16(19)10-6-4-3-5-7-10/h8-10,15-16,19H,3-7,18H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | AAIPYCQFVDESTC-JKSUJKDBSA-N |
| XLogP | 3.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |