C16H25NO3 — CID 171162272
(1R,2S)-2-amino-1-cyclohexyl-2-(3,5-dimethoxyphenyl)ethanol (PubChem CID 171162272) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclohexyl-2-(3,5-dimethoxyphenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclohexyl-2-(3,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 171162272 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclohexyl-2-(3,5-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)cc([C@H](N)[C@H](O)C2CCCCC2)c1 |
| InChI | InChI=1S/C16H25NO3/c1-19-13-8-12(9-14(10-13)20-2)15(17)16(18)11-6-4-3-5-7-11/h8-11,15-16,18H,3-7,17H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | IEEWMONHULHUBV-JKSUJKDBSA-N |
| XLogP | 2.64 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |