C13H16Br3NO2 — CID 171266180
3-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-2,4,6-tribromophenol (PubChem CID 171266180) has the molecular formula C13H16Br3NO2 and a molecular weight of 457.99 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 171266180 |
| Molecular Formula | C13H16Br3NO2 |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 454.87 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]-2,4,6-tribromophenol |
| SMILES | N[C@H](c1c(Br)cc(Br)c(O)c1Br)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C13H16Br3NO2/c14-7-5-8(15)13(19)10(16)9(7)11(17)12(18)6-3-1-2-4-6/h5-6,11-12,18-19H,1-4,17H2/t11-,12+/m1/s1 |
| InChIKey | VJOZVWIKALTKGZ-NEPJUHHUSA-N |
| XLogP | 4.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |