C12H14BrF2NO — CID 171268665
(1R,2S)-2-amino-2-(4-bromo-2,6-difluorophenyl)-1-cyclobutylethanol (PubChem CID 171268665) has the molecular formula C12H14BrF2NO and a molecular weight of 306.15 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(4-bromo-2,6-difluorophenyl)-1-cyclobutylethanol.
| Compound Name | (1R,2S)-2-amino-2-(4-bromo-2,6-difluorophenyl)-1-cyclobutylethanol |
|---|---|
| PubChem CID | 171268665 |
| Molecular Formula | C12H14BrF2NO |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | (1R,2S)-2-amino-2-(4-bromo-2,6-difluorophenyl)-1-cyclobutylethanol |
| SMILES | N[C@@H](c1c(F)cc(Br)cc1F)[C@H](O)C1CCC1 |
| InChI | InChI=1S/C12H14BrF2NO/c13-7-4-8(14)10(9(15)5-7)11(16)12(17)6-2-1-3-6/h4-6,11-12,17H,1-3,16H2/t11-,12+/m0/s1 |
| InChIKey | DYGDJHXQFQENQS-NWDGAFQWSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |