C12H15ClF3NO — CID 171161583
(1R,2S)-2-amino-1-cyclobutyl-2-(2,4,5-trifluorophenyl)ethanol;hydrochloride (PubChem CID 171161583) has the molecular formula C12H15ClF3NO and a molecular weight of 281.71 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclobutyl-2-(2,4,5-trifluorophenyl)ethanol;hydrochloride.
| Compound Name | (1R,2S)-2-amino-1-cyclobutyl-2-(2,4,5-trifluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171161583 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclobutyl-2-(2,4,5-trifluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(F)c(F)cc1F)[C@H](O)C1CCC1 |
| InChI | InChI=1S/C12H14F3NO.ClH/c13-8-5-10(15)9(14)4-7(8)11(16)12(17)6-2-1-3-6;/h4-6,11-12,17H,1-3,16H2;1H/t11-,12+;/m0./s1 |
| InChIKey | XYFUOZWOHMNNSG-ZVWHLABXSA-N |
| XLogP | 2.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|