C13H17ClF3NO — CID 171262501
(1S,2R)-2-amino-1-cyclopentyl-2-(2,3,5-trifluorophenyl)ethanol;hydrochloride (PubChem CID 171262501) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopentyl-2-(2,3,5-trifluorophenyl)ethanol;hydrochloride.
| Compound Name | (1S,2R)-2-amino-1-cyclopentyl-2-(2,3,5-trifluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171262501 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopentyl-2-(2,3,5-trifluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(F)cc(F)c1F)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C13H16F3NO.ClH/c14-8-5-9(11(16)10(15)6-8)12(17)13(18)7-3-1-2-4-7;/h5-7,12-13,18H,1-4,17H2;1H/t12-,13+;/m1./s1 |
| InChIKey | MWOXSEOQLDPAEG-KZCZEQIWSA-N |
| XLogP | 3.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|