C14H20ClFINO — CID 171266073
(1S,2R)-2-amino-1-cyclohexyl-2-(2-fluoro-5-iodophenyl)ethanol;hydrochloride (PubChem CID 171266073) has the molecular formula C14H20ClFINO and a molecular weight of 399.68 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclohexyl-2-(2-fluoro-5-iodophenyl)ethanol;hydrochloride.
| Compound Name | (1S,2R)-2-amino-1-cyclohexyl-2-(2-fluoro-5-iodophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171266073 |
| Molecular Formula | C14H20ClFINO |
| Molecular Weight | 399.68 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclohexyl-2-(2-fluoro-5-iodophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(I)ccc1F)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H19FINO.ClH/c15-12-7-6-10(16)8-11(12)13(17)14(18)9-4-2-1-3-5-9;/h6-9,13-14,18H,1-5,17H2;1H/t13-,14+;/m1./s1 |
| InChIKey | LTZNHWWZXJMEEV-DFQHDRSWSA-N |
| XLogP | 3.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|