C15H20BrF2N — CID 104992584
(4-bromo-2,6-difluorophenyl)-(3-ethylcyclohexyl)methanamine (PubChem CID 104992584) has the molecular formula C15H20BrF2N and a molecular weight of 332.23 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(3-ethylcyclohexyl)methanamine.
| Compound Name | (4-bromo-2,6-difluorophenyl)-(3-ethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 104992584 |
| Molecular Formula | C15H20BrF2N |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(3-ethylcyclohexyl)methanamine |
| SMILES | CCC1CCCC(C(N)c2c(F)cc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H20BrF2N/c1-2-9-4-3-5-10(6-9)15(19)14-12(17)7-11(16)8-13(14)18/h7-10,15H,2-6,19H2,1H3 |
| InChIKey | SGFFQNXDCZPQLW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |