C8H11Br2ClN2O — CID 171256229
3,5-dibromo-2-[(1S)-1,2-diaminoethyl]phenol;hydrochloride (PubChem CID 171256229) has the molecular formula C8H11Br2ClN2O and a molecular weight of 346.45 g/mol. Its IUPAC name is 3,5-dibromo-2-[(1S)-1,2-diaminoethyl]phenol;hydrochloride.
| Compound Name | 3,5-dibromo-2-[(1S)-1,2-diaminoethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171256229 |
| Molecular Formula | C8H11Br2ClN2O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 343.89 |
| IUPAC Name | 3,5-dibromo-2-[(1S)-1,2-diaminoethyl]phenol;hydrochloride |
| SMILES | Cl.NC[C@@H](N)c1c(O)cc(Br)cc1Br |
| InChI | InChI=1S/C8H10Br2N2O.ClH/c9-4-1-5(10)8(6(12)3-11)7(13)2-4;/h1-2,6,13H,3,11-12H2;1H/t6-;/m1./s1 |
| InChIKey | VFYGUTRRPCLJHY-FYZOBXCZSA-N |
| XLogP | 2.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|