C11H12Br2FNO3 — CID 171252900
ethyl (3R)-3-amino-3-(2,4-dibromo-6-hydroxyphenyl)-2-fluoropropanoate (PubChem CID 171252900) has the molecular formula C11H12Br2FNO3 and a molecular weight of 385.03 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2,4-dibromo-6-hydroxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-(2,4-dibromo-6-hydroxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171252900 |
| Molecular Formula | C11H12Br2FNO3 |
| Molecular Weight | 385.03 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2,4-dibromo-6-hydroxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1c(O)cc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2FNO3/c1-2-18-11(17)9(14)10(15)8-6(13)3-5(12)4-7(8)16/h3-4,9-10,16H,2,15H2,1H3/t9?,10-/m1/s1 |
| InChIKey | UUPYORXRCBNQKY-QVDQXJPCSA-N |
| XLogP | 2.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.03 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|